* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5H-PYRIDO[4,3-B]INDOLE |
| CAS: | 244-69-9 |
| English Synonyms: | 3-AZACARBAZOLE ; 5H-PYRIDO[4,3-B]INDOLE |
| MDL Number.: | MFCD00965976 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c3cnccc3[nH]2 |
| InChi: | InChI=1S/C11H8N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-7,13H |
| InChiKey: | InChIKey=RDMFHRSPDKWERA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.