* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5H-INDENO[1,2-B]PYRIDINE |
CAS: | 244-99-5 |
English Synonyms: | 5H-INDENO[1,2-B]PYRIDINE |
MDL Number.: | MFCD00780991 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc-2c(c1)Cc3c2nccc3 |
InChi: | InChI=1S/C12H9N/c1-2-6-11-9(4-1)8-10-5-3-7-13-12(10)11/h1-7H,8H2 |
InChiKey: | InChIKey=FWEHZHRUCQRSJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.