* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-CYCLOHEXEN-1-ONE, 4-HYDROXY-2-METHYL-5-(1-METHYLETHYL)-, (5R)- |
| CAS: | 244135-17-9 |
| English Synonyms: | 2-CYCLOHEXEN-1-ONE, 4-HYDROXY-2-METHYL-5-(1-METHYLETHYL)-, (5R)- |
| MDL Number.: | MFCD18834112 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1=CC([C@H](CC1=O)C(C)C)O |
| InChi: | InChI=1S/C10H16O2/c1-6(2)8-5-9(11)7(3)4-10(8)12/h4,6,8,10,12H,5H2,1-3H3/t8-,10?/m1/s1 |
| InChiKey: | InChIKey=ZFUJCNJIGDBFEP-HNHGDDPOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.