* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 12,13-DIHYDRO-1,11-DIMETHYL-5H-INDOLO[2,3-A]PYRROLO[3,4-C]CARBAZOLE-5,7(6H)-DIONE |
CAS: | 245106-23-4 |
English Synonyms: | 12,13-DIHYDRO-1,11-DIMETHYL-5H-INDOLO[2,3-A]PYRROLO[3,4-C]CARBAZOLE-5,7(6H)-DIONE |
MDL Number.: | MFCD17012197 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cc1cccc2c1[nH]c3c2c4c(c5c3[nH]c6c5cccc6C)C(=O)NC4=O |
InChi: | InChI=1S/C22H15N3O2/c1-9-5-3-7-11-13-15-16(22(27)25-21(15)26)14-12-8-4-6-10(2)18(12)24-20(14)19(13)23-17(9)11/h3-8,23-24H,1-2H3,(H,25,26,27) |
InChiKey: | InChIKey=DYJPDRYQOSBRFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.