* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Propanediamine, N1-(4-iodophenyl)- |
CAS: | 246533-56-2 |
English Synonyms: | 1,3-PROPANEDIAMINE, N1-(4-IODOPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | IC1=CC=C(C=C1)NCCCN |
InChi: | InChI=1S/C9H13IN2/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5,12H,1,6-7,11H2 |
InChiKey: | InChIKey=XFVDMDGAAUWWKZ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.