* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | TEREPHTYL |
| CAS: | 2468-28-2 |
| English Synonyms: | TEREPHTYL |
| MDL Number.: | MFCD01180359 |
| H bond acceptor: | 12 |
| H bond donor: | 2 |
| Smile: | Cc1cc(nc(n1)NS(=O)(=O)c2ccc(cc2)/N=C/c3ccc(cc3)/C=N/c4ccc(cc4)S(=O)(=O)Nc5nc(cc(n5)C)C)C |
| InChi: | InChI=1S/C32H30N8O4S2/c1-21-17-22(2)36-31(35-21)39-45(41,42)29-13-9-27(10-14-29)33-19-25-5-7-26(8-6-25)20-34-28-11-15-30(16-12-28)46(43,44)40-32-37-23(3)18-24(4)38-32/h5-20H,1-4H3,(H,35,36,39)(H,37,38,40)/b33-19+,34-20+ |
| InChiKey: | InChIKey=IQSUTADSCNTAFQ-ZXHXELASSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.