* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-ILE-ALA-OH |
CAS: | 24787-83-5 |
English Synonyms: | Z-L-ISOLEUCYL-L-ALANINE ; Z-ILE-ALA-OH |
MDL Number.: | MFCD00020396 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C17H24N2O5/c1-4-11(2)14(15(20)18-12(3)16(21)22)19-17(23)24-10-13-8-6-5-7-9-13/h5-9,11-12,14H,4,10H2,1-3H3,(H,18,20)(H,19,23)(H,21,22)/t11-,12-,14-/m0/s1 |
InChiKey: | InChIKey=ODCYXWIILYCUCZ-OBJOEFQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.