* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-MET-ALA-OH |
CAS: | 24787-85-7 |
English Synonyms: | Z-MET-ALA-OH |
MDL Number.: | MFCD00029988 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)O)NC(=O)[C@H](CCSC)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C16H22N2O5S/c1-11(15(20)21)17-14(19)13(8-9-24-2)18-16(22)23-10-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,17,19)(H,18,22)(H,20,21)/t11-,13-/m0/s1 |
InChiKey: | InChIKey=WNPCADDTHHEWIB-AAEUAGOBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.