* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINBOLONE |
| CAS: | 2487-63-0 |
| English Synonyms: | QUINBOLONE |
| MDL Number.: | MFCD00864187 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2OC4=CCCC4)CCC5=CC(=O)C=C[C@]35C |
| InChi: | InChI=1S/C24H32O2/c1-23-13-11-17(25)15-16(23)7-8-19-20-9-10-22(26-18-5-3-4-6-18)24(20,2)14-12-21(19)23/h5,11,13,15,19-22H,3-4,6-10,12,14H2,1-2H3/t19-,20-,21-,22-,23-,24-/m0/s1 |
| InChiKey: | InChIKey=IUVKMZGDUIUOCP-BTNSXGMBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.