* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (-)-ISOSATIVENE |
| CAS: | 24959-83-9 |
| English Synonyms: | (-)-ISOSATIVENE |
| MDL Number.: | MFCD00084735 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | CC(C)[C@@H]1CC[C@]2([C@H]3[C@@H]1C[C@H](C3)C2=C)C |
| InChi: | InChI=1S/C15H24/c1-9(2)12-5-6-15(4)10(3)11-7-13(12)14(15)8-11/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13-,14-,15-/m1/s1 |
| InChiKey: | InChIKey=CGZBLYYTRIVVTD-XLWJZTARSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.