* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-AMINO-3-(2,2-DIMETHOXY-ETHYL)-PHENOL |
CAS: | 250739-30-1 |
English Synonyms: | 4-AMINO-3-(2,2-DIMETHOXY-ETHYL)-PHENOL ; TODD-LINKER |
MDL Number.: | MFCD03093391 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COC(Cc1cc(ccc1N)O)OC |
InChi: | InChI=1S/C10H15NO3/c1-13-10(14-2)6-7-5-8(12)3-4-9(7)11/h3-5,10,12H,6,11H2,1-2H3 |
InChiKey: | InChIKey=ZKIYQLYEPCQCBB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.