Molecular Structure:
CAS No.:
251649-40-8
Product Name.:
CCD No.:CCD03029249
Formula:C10 H8 N2 O3
MolWeight:204.184
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(5)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | 3-NITRO-4-(1H-PYRROL-1-YL)BENZENOL |
| CAS： | 251649-40-8 |
| English Synonyms： | 3-NITRO-4-(1H-PYRROL-1-YL)BENZENOL |
| MDL Number.： | MFCD16622793 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1ccn(c1)c2ccc(cc2[N+](=O)[O-])O |
| InChi： | InChI=1S/C10H8N2O3/c13-8-3-4-9(10(7-8)12(14)15)11-5-1-2-6-11/h1-7,13H |
| InChiKey： | InChIKey=GGPUCGQKCDVAHA-UHFFFAOYSA-N |
|
|
| Melting Point： | 156 DEG |
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
