* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PHE-GLY-PHE-GLY-OH |
CAS: | 252351-91-0 |
English Synonyms: | Z-PHE-GLY-PHE-GLY-OH |
MDL Number.: | MFCD00238497 |
H bond acceptor: | 11 |
H bond donor: | 5 |
Smile: | c1ccc(cc1)C[C@@H](C(=O)NCC(=O)O)NC(=O)CNC(=O)[C@H](Cc2ccccc2)NC(=O)OCc3ccccc3 |
InChi: | InChI=1S/C30H32N4O7/c35-26(33-24(28(38)32-19-27(36)37)16-21-10-4-1-5-11-21)18-31-29(39)25(17-22-12-6-2-7-13-22)34-30(40)41-20-23-14-8-3-9-15-23/h1-15,24-25H,16-20H2,(H,31,39)(H,32,38)(H,33,35)(H,34,40)(H,36,37)/t24-,25-/m0/s1 |
InChiKey: | InChIKey=RRWHQMMZEXUSBZ-DQEYMECFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.