* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-GLY-ILE-ALA-OH |
CAS: | 252573-80-1 |
English Synonyms: | Z-GLY-ILE-ALA-OH |
MDL Number.: | MFCD00238456 |
H bond acceptor: | 9 |
H bond donor: | 4 |
Smile: | CC[C@H](C)[C@@H](C(=O)N[C@@H](C)C(=O)O)NC(=O)CNC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C19H27N3O6/c1-4-12(2)16(17(24)21-13(3)18(25)26)22-15(23)10-20-19(27)28-11-14-8-6-5-7-9-14/h5-9,12-13,16H,4,10-11H2,1-3H3,(H,20,27)(H,21,24)(H,22,23)(H,25,26)/t12-,13-,16-/m0/s1 |
InChiKey: | InChIKey=AMALWJTXQRCTGO-XEZPLFJOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.