* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-NLE-NLE-OH |
CAS: | 252573-92-5 |
English Synonyms: | Z-NLE-NLE-OH |
MDL Number.: | MFCD00238487 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CCCC[C@@H](C(=O)N[C@@H](CCCC)C(=O)O)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C20H30N2O5/c1-3-5-12-16(18(23)21-17(19(24)25)13-6-4-2)22-20(26)27-14-15-10-8-7-9-11-15/h7-11,16-17H,3-6,12-14H2,1-2H3,(H,21,23)(H,22,26)(H,24,25)/t16-,17-/m0/s1 |
InChiKey: | InChIKey=WFQHTBYDWHZANB-IRXDYDNUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.