* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SPILANTHOL |
CAS: | 25394-57-4 |
English Synonyms: | SPILANTHOL |
MDL Number.: | MFCD01736093 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C\C=C\CC/C=C/C(=O)NCC(C)C |
InChi: | InChI=1S/C14H23NO/c1-4-5-6-7-8-9-10-11-14(16)15-12-13(2)3/h4-7,10-11,13H,8-9,12H2,1-3H3,(H,15,16)/b5-4-,7-6+,11-10+ |
InChiKey: | InChIKey=BXOCHUWSGYYSFW-NIYQBQGDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.