* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CINERIN I |
CAS: | 25402-06-6 |
English Synonyms: | CINERIN I |
MDL Number.: | MFCD01735821 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | C/C=C/CC1=C(C(CC1=O)OC(=O)C2C(C2(C)C)C=C(C)C)C |
InChi: | InChI=1S/C20H28O3/c1-7-8-9-14-13(4)17(11-16(14)21)23-19(22)18-15(10-12(2)3)20(18,5)6/h7-8,10,15,17-18H,9,11H2,1-6H3/b8-7+ |
InChiKey: | InChIKey=FMTFEIJHMMQUJI-BQYQJAHWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.