* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-PHENYL-1H-1,2,4-TRIAZOL-5-YL)-BENZENAMINE |
CAS: | 25518-15-4 |
English Synonyms: | BENZENAMINE, 2-(3-PHENYL-1H-1,2,4-TRIAZOL-5-YL)- ; 2-(3-PHENYL-1H-1,2,4-TRIAZOL-5-YL)-BENZENAMINE |
MDL Number.: | MFCD00839706 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)c2nc([nH]n2)Nc3ccccc3 |
InChi: | InChI=1S/C14H12N4/c1-3-7-11(8-4-1)13-16-14(18-17-13)15-12-9-5-2-6-10-12/h1-10H,(H2,15,16,17,18) |
InChiKey: | InChIKey=MLTGRXZOMWSTOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.