* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | HOMEOSTAN |
CAS: | 25614-78-2 |
English Synonyms: | HOMEOSTAN ; 3-ACETYL-1-[(2Z)-2-ETHYLBUT-2-ENOYL]UREA |
MDL Number.: | MFCD01751016 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC/C(=C/C)/C(=O)NC(=O)NC(=O)C |
InChi: | InChI=1S/C9H14N2O3/c1-4-7(5-2)8(13)11-9(14)10-6(3)12/h4H,5H2,1-3H3,(H2,10,11,12,13,14)/b7-4- |
InChiKey: | InChIKey=GIVGVNLRHLKCMH-DAXSKMNVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.