* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Butanol, 4-[(4-bromophenyl)methoxy]- |
CAS: | 256494-24-3 |
English Synonyms: | 1-BUTANOL, 4-[(4-BROMOPHENYL)METHOXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC1=CC=C(C=C1)COCCCCO |
InChi: | InChI=1S/C11H15BrO2/c12-11-5-3-10(4-6-11)9-14-8-2-1-7-13/h3-6,13H,1-2,7-9H2 |
InChiKey: | InChIKey=BUHUFFHXOGTXPW-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.