* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GALLIUM ACETATE |
CAS: | 2571-06-4 |
English Synonyms: | GALLIUM ACETATE |
MDL Number.: | MFCD00156533 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC(=O)O[Ga](OC(=O)C)OC(=O)C |
InChi: | InChI=1S/3C2H4O2.Ga/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3 |
InChiKey: | InChIKey=FYWVTSQYJIPZLW-UHFFFAOYSA-K |
* If the product has intellectual property rights, a license granted is must or contact us.