* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-AMINO-3-(4-METHOXYANILINO)-6-[2-(2-THIENYL)VINYL]-1,2,4-TRIAZIN-5(4H)-ONE |
CAS: | 257869-81-1 |
English Synonyms: | 4-AMINO-3-(4-METHOXYANILINO)-6-[2-(2-THIENYL)VINYL]-1,2,4-TRIAZIN-5(4H)-ONE |
MDL Number.: | MFCD01312206 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1)Nc2nnc(c(=O)n2N)/C=C/c3cccs3 |
InChi: | InChI=1S/C16H15N5O2S/c1-23-12-6-4-11(5-7-12)18-16-20-19-14(15(22)21(16)17)9-8-13-3-2-10-24-13/h2-10H,17H2,1H3,(H,18,20)/b9-8+ |
InChiKey: | InChIKey=PLQIRNZFLQBFHD-CMDGGOBGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.