* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(2-FLUOROETHYL)-8-AZABICYCLO[3.2.1]OCTAN-3-OL |
| CAS: | 259092-14-3 |
| English Synonyms: | 8-(2-FLUOROETHYL)-8-AZABICYCLO[3.2.1]OCTAN-3-OL |
| MDL Number.: | MFCD13179459 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C1C[C@@H]2CC(C[C@H]1N2CCF)O |
| InChi: | InChI=1S/C9H16FNO/c10-3-4-11-7-1-2-8(11)6-9(12)5-7/h7-9,12H,1-6H2/t7-,8+,9? |
| InChiKey: | InChIKey=DVDHZMHNIYEETC-JVHMLUBASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.