* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DOWET-15 |
| CAS: | 2591-66-4 |
| English Synonyms: | DOWET-15 |
| MDL Number.: | MFCD01705762 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | COP(=S)(N)Oc1cc(c(cc1Cl)Cl)Cl |
| InChi: | InChI=1S/C7H7Cl3NO2PS/c1-12-14(11,15)13-7-3-5(9)4(8)2-6(7)10/h2-3H,1H3,(H2,11,15) |
| InChiKey: | InChIKey=WRWBHVIYUCQSIA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.