* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | D-(+)-ALLOSE |
CAS: | 2595-97-3 ;7283-09-2 |
English Synonyms: | (2R,3R,4R,5R)-2,3,4,5,6-PENTAHYDROXYHEXANAL ; BETA-D-ALLOPYRANOSE ; ALLOSE, D-(+)- ; D-ALLOSE ; D-(+)-ALLOSE |
MDL Number.: | MFCD00135833 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | C([C@H]([C@H]([C@H]([C@H](C=O)O)O)O)O)O |
InChi: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5-,6+/m0/s1 |
InChiKey: | InChIKey=GZCGUPFRVQAUEE-BGPJRJDNSA-N |
Property |
|
Melting Point: | 143.7 DEG C |
Safety information |
|
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.