* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRAZITILINE |
CAS: | 26070-23-5 |
English Synonyms: | TRAZITILINE |
MDL Number.: | MFCD00868486 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CN1CCN(CC1)C23CCC(c4c2cccc4)c5c3cccc5 |
InChi: | InChI=1S/C21H24N2/c1-22-12-14-23(15-13-22)21-11-10-16(17-6-2-4-8-19(17)21)18-7-3-5-9-20(18)21/h2-9,16H,10-15H2,1H3 |
InChiKey: | InChIKey=MXZCHCNRTUYWKE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.