* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-ETHYL-5-PYRIDIN-3-YL-4H-[1,2,4]TRIAZOLE-3-THIOL |
CAS: | 26131-68-0 |
English Synonyms: | ZERENEX E/1009891 ; 4-ETHYL-5-PYRIDIN-3-YL-4H-[1,2,4]TRIAZOLE-3-THIOL ; 4-ETHYL-5-(3-PYRIDYL)-1,2,4-TRIAZOLE-3-THIOL |
MDL Number.: | MFCD02229826 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCn1c(nnc1S)c2cccnc2 |
InChi: | InChI=1S/C9H10N4S/c1-2-13-8(11-12-9(13)14)7-4-3-5-10-6-7/h3-6H,2H2,1H3,(H,12,14) |
InChiKey: | InChIKey=NCPZCRVLFQRVRR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.