Molecular Structure:
CAS No.:
261360-75-2
Product Name.:
CCD No.:CCD00231061
Formula:C7 H6 O2 . C4 H9 N O
MolWeight:209.243
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(8)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | (S)-2-AMINOBUT-3-EN-1-OL, BENZOATE SALT |
| CAS： | 261360-75-2 |
| English Synonyms： | (S)-2-AMINOBUT-3-EN-1-OL, BENZOATE SALT |
| MDL Number.： | MFCD01631079 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | C=C[C@@H](CO)N.c1ccc(cc1)C(=O)O |
| InChi： | InChI=1S/C7H6O2.C4H9NO/c8-7(9)6-4-2-1-3-5-6;1-2-4(5)3-6/h1-5H,(H,8,9);2,4,6H,1,3,5H2/t;4-/m.0/s1 |
| InChiKey： | InChIKey=HFAZTHPBSQNAFO-VWMHFEHESA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
