* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,6-DIFLUORO-2-AZA-BICYCLO[2.2.1]HEPTAN-3-ONE |
| CAS: | 262280-03-5 |
| English Synonyms: | 6,6-DIFLUORO-2-AZA-BICYCLO[2.2.1]HEPTAN-3-ONE |
| MDL Number.: | MFCD12828529 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C1[C@@H]2CC([C@H]1NC2=O)(F)F |
| InChi: | InChI=1S/C6H7F2NO/c7-6(8)2-3-1-4(6)9-5(3)10/h3-4H,1-2H2,(H,9,10)/t3-,4+/m1/s1 |
| InChiKey: | InChIKey=SLZZVCBTGYVHDY-DMTCNVIQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.