* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 4-(2-IODOPHENYL)-4-OXOBUTYRATE |
| CAS: | 263273-52-5 |
| English Synonyms: | ETHYL 4-(2-IODOPHENYL)-4-OXOBUTYRATE |
| MDL Number.: | MFCD02261309 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCC(=O)c1ccccc1I |
| InChi: | InChI=1S/C12H13IO3/c1-2-16-12(15)8-7-11(14)9-5-3-4-6-10(9)13/h3-6H,2,7-8H2,1H3 |
| InChiKey: | InChIKey=SQRWBNWBGWGXJN-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.