* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9,10,12,13-TETRACHLOROOCTADECANOIC ACID |
| CAS: | 26533-39-1 |
| English Synonyms: | 9,10,12,13-TETRACHLOROOCTADECANOIC ACID |
| MDL Number.: | MFCD11111172 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCCCCC(C(CC(C(CCCCCCCC(=O)O)Cl)Cl)Cl)Cl |
| InChi: | InChI=1S/C18H32Cl4O2/c1-2-3-7-10-14(19)16(21)13-17(22)15(20)11-8-5-4-6-9-12-18(23)24/h14-17H,2-13H2,1H3,(H,23,24) |
| InChiKey: | InChIKey=FRSRMUYUIAXUAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.