* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXAFLOZANE |
| CAS: | 26629-87-8 |
| English Synonyms: | OXAFLOZANE |
| MDL Number.: | MFCD00865400 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)N1CCOC(C1)c2cccc(c2)C(F)(F)F |
| InChi: | InChI=1S/C14H18F3NO/c1-10(2)18-6-7-19-13(9-18)11-4-3-5-12(8-11)14(15,16)17/h3-5,8,10,13H,6-7,9H2,1-2H3 |
| InChiKey: | InChIKey=FVYUQFQCEOZYHZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.