* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ASCORBIGEN |
| CAS: | 8075-98-7 ;26676-89-1 |
| English Synonyms: | ASCORBIGEN A ; ASCORBIGEN |
| MDL Number.: | MFCD00084842 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | c1ccc2c(c1)c(c[nH]2)C[C@]3(C(=O)O[C@H]4[C@@]3(OC[C@@H]4O)O)O |
| InChi: | InChI=1S/C15H15NO6/c17-11-7-21-15(20)12(11)22-13(18)14(15,19)5-8-6-16-10-4-2-1-3-9(8)10/h1-4,6,11-12,16-17,19-20H,5,7H2/t11-,12+,14+,15-/m0/s1 |
| InChiKey: | InChIKey=OMSJCIOTCFHSIT-MXYBEHONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.