* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TRIARIMOL |
CAS: | 26766-27-8 |
English Synonyms: | TRIARIMOL |
MDL Number.: | MFCD01689393 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C(c2ccc(cc2Cl)Cl)(c3cncnc3)O |
InChi: | InChI=1S/C17H12Cl2N2O/c18-14-6-7-15(16(19)8-14)17(22,12-4-2-1-3-5-12)13-9-20-11-21-10-13/h1-11,22H |
InChiKey: | InChIKey=MYUPFXPCYUISAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.