* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-PYRAZOLO[3,4-B]QUINOLINE |
CAS: | 268-93-9 |
English Synonyms: | 1H-PYRAZOLO[3,4-B]QUINOLINE |
MDL Number.: | MFCD02269532 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)cc3cn[nH]c3n2 |
InChi: | InChI=1S/C10H7N3/c1-2-4-9-7(3-1)5-8-6-11-13-10(8)12-9/h1-6H,(H,11,12,13) |
InChiKey: | InChIKey=ZIZLPQUGUOCJQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.