* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-Bromo-3-chloro-1H-pyrazole |
CAS: | 27258-18-0 |
English Synonyms: | 4-BROMO-3-CHLORO-1H-PYRAZOLE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrC=1C(=NNC1)Cl |
InChi: | InChI=1S/C3H2BrClN2/c4-2-1-6-7-3(2)5/h1H,(H,6,7) |
InChiKey: | InChIKey=LASSLNHDRZFHLG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.