* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-4,4'-dicarboxaldehyde, 3,3'-dimethyl- |
CAS: | 27343-99-3 |
English Synonyms: | [1,1'-BIPHENYL]-4,4'-DICARBOXALDEHYDE, 3,3'-DIMETHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC=1C=C(C=CC1C=O)C1=CC(=C(C=C1)C=O)C |
InChi: | InChI=1S/C16H14O2/c1-11-7-13(3-5-15(11)9-17)14-4-6-16(10-18)12(2)8-14/h3-10H,1-2H3 |
InChiKey: | InChIKey=OMVBTWICWLHSKH-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.