* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PYRAZOLO[1,5-A]PYRIDINE |
CAS: | 274-56-6 |
English Synonyms: | 3-AZAINDOLINE ; PYRAZOLO[1,5-A]PYRIDINE |
MDL Number.: | MFCD08752622 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccn2c(c1)ccn2 |
InChi: | InChI=1S/C7H6N2/c1-2-6-9-7(3-1)4-5-8-9/h1-6H |
InChiKey: | InChIKey=DVUBDHRTVYLIPA-UHFFFAOYSA-N |
Property |
|
Boiling Point: | 37-39 DEG C/0.2MM |
Physical Property: | REFRACTIVE INDEX: 1.6075 |
Comments: | HAZARD: R 36/37/38 HAZARD: S 26-36-60 TSCA: N UNSPSC: 12000000 |
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.