* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | IMIDAZO[1,2-A]PYRAZINE |
CAS: | 274-79-3 |
English Synonyms: | IMIDAZO[1,2-A]PYRAZINE |
MDL Number.: | MFCD06245371 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cn2ccnc2cn1 |
InChi: | InChI=1S/C6H5N3/c1-3-9-4-2-8-6(9)5-7-1/h1-5H |
InChiKey: | InChIKey=MBVAHHOKMIRXLP-UHFFFAOYSA-N |
Property |
|
Melting Point: | 90-94 DEG C |
Comments: | UNSPSC: 12352100 WGK: 3 |
Safety information |
|
Symbol: | GHS07 |
Signal word: | Warning |
Hazard statements: | H315-H317-H319-H335 |
Precautionary statements: | P261-P280-P305 + P351 + P338 |
hazard symbol: | Xi |
Risk Code: | R:36/37/38-43 |
Safe Code: | S:26-36/37 |
WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.