* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,2,3,4]TETRAAZOLO[1,5-A]PYRIDINE |
CAS: | 274-87-3 |
English Synonyms: | [1,2,3,4]TETRAAZOLO[1,5-A]PYRIDINE ; [1,2,3,4]TETRAZOLO[1,5-A]PYRIDINE ; TETRAZOLO[1,5-A]PYRIDINE |
MDL Number.: | MFCD00829444 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccn2c(c1)nnn2 |
InChi: | InChI=1S/C5H4N4/c1-2-4-9-5(3-1)6-7-8-9/h1-4H |
InChiKey: | InChIKey=BPDSGGQFORKTMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.