* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOXAZOLO[5,4-D][1,3]THIAZEPINE |
CAS: | 27629-49-8 |
English Synonyms: | [1,2]OXAZOLO[5,4-D][1,3]THIAZEPINE ; ISOXAZOLO[5,4-D][1,3]THIAZEPINE |
MDL Number.: | MFCD16250042 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1c2c(on1)N=CSC=C2 |
InChi: | InChI=1S/C6H4N2OS/c1-2-10-4-7-6-5(1)3-8-9-6/h1-4H |
InChiKey: | InChIKey=KAUHWLTUPGNARS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.