* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ISOXAZOLO[5,4-D][1,3]THIAZEPINE |
| CAS: | 27629-49-8 |
| English Synonyms: | ISOXAZOLO[5,4-D][1,3]THIAZEPINE ; [1,2]OXAZOLO[5,4-D][1,3]THIAZEPINE |
| MDL Number.: | MFCD16250042 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1c2c(on1)N=CSC=C2 |
| InChi: | InChI=1S/C6H4N2OS/c1-2-10-4-7-6-5(1)3-8-9-6/h1-4H |
| InChiKey: | InChIKey=KAUHWLTUPGNARS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.