* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Z-VAL-GLY-OET |
CAS: | 2766-17-8 |
English Synonyms: | Z-VAL-GLY-OET |
MDL Number.: | MFCD00056285 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCOC(=O)CNC(=O)[C@H](C(C)C)NC(=O)OCc1ccccc1 |
InChi: | InChI=1S/C17H24N2O5/c1-4-23-14(20)10-18-16(21)15(12(2)3)19-17(22)24-11-13-8-6-5-7-9-13/h5-9,12,15H,4,10-11H2,1-3H3,(H,18,21)(H,19,22)/t15-/m0/s1 |
InChiKey: | InChIKey=FZTGKCOLBDXREB-HNNXBMFYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.