Molecular Structure:
CAS No.:
279-49-2
Product Name.:
CCD No.:CCD00051663
Formula:C6 H10 O
MolWeight:98.144
![7-OXABICYCLO[2.2.1]HEPTANE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(16)
- Buyers(0)
- Spectrum(0)
- MSDS(3)
- Price(8)
|
|
| Product Name： | 7-OXABICYCLO[2.2.1]HEPTANE |
| CAS： | 279-49-2 |
| English Synonyms： | 7-OXABICYCLO[2.2.1]HEPTANE ; 1,4-EPOXYCYCLOHEXANE |
| MDL Number.： | MFCD00082342 |
| H bond acceptor： | 1 |
| H bond donor： | 0 |
| Smile： | C1C[C@@H]2CC[C@H]1O2 |
| InChi： | InChI=1S/C6H10O/c1-2-6-4-3-5(1)7-6/h5-6H,1-4H2/t5-,6+ |
| InChiKey： | InChIKey=YPWFNLSXQIGJCK-OLQVQODUSA-N |
|
|
| Boiling Point： | 119 DEG C/713 MMHG(LIT) |
| Density： | DENSITY: 0.968 G/ML AT 25 DEG C(LIT) |
| Physical Property： | FLASHPOINT: 13 DEG C FLASHPOINT: 55.4 DEG F REFRACTIVE INDEX: N20/D 1.448(LIT) |
| Comments： | RIDADR: UN 1993 3/PG 2 UNSPSC: 12352100 WGK: 3 |
|
|
| Symbol： |
GHS02
|
| Signal word： | Danger |
| Hazard statements： | H225 |
| Precautionary statements： | P210 |
| hazard symbol： | F |
| Risk Code： | R:11 |
| Safe Code： | S:16-29-33 |
| WGK Germany： | 3 |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
