* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-FLUOREN-4-OL |
CAS: | 28147-35-5 |
English Synonyms: | 9H-FLUOREN-4-OL |
MDL Number.: | MFCD00032803 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc-2c(c1)Cc3c2c(ccc3)O |
InChi: | InChI=1S/C13H10O/c14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7,14H,8H2 |
InChiKey: | InChIKey=ANGFHRWEXHAILW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.