* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,6-DIIODOPHENOL |
CAS: | 28177-54-0 |
English Synonyms: | PHENOL, 2,6-DIIODO- ; 2,6-DIIODOPHENOL |
MDL Number.: | MFCD16999868 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)I)O)I |
InChi: | InChI=1S/C6H4I2O/c7-4-2-1-3-5(8)6(4)9/h1-3,9H |
InChiKey: | InChIKey=VMGBDTCTVUUNAO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.