* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DIACETOLOL |
CAS: | 28197-69-5 |
English Synonyms: | DIACETOLOL |
MDL Number.: | MFCD00864561 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC(C)NCC(COc1ccc(cc1C(=O)C)NC(=O)C)O |
InChi: | InChI=1S/C16H24N2O4/c1-10(2)17-8-14(21)9-22-16-6-5-13(18-12(4)20)7-15(16)11(3)19/h5-7,10,14,17,21H,8-9H2,1-4H3,(H,18,20) |
InChiKey: | InChIKey=AWOGXJOBNAWQSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.