* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-(+)-DELTA-DECANOLACTONE |
CAS: | 2825-91-4 |
English Synonyms: | (R)-(+)-DELTA-DECANOLACTONE |
MDL Number.: | MFCD01862987 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCCC[C@@H]1CCCC(=O)O1 |
InChi: | InChI=1S/C10H18O2/c1-2-3-4-6-9-7-5-8-10(11)12-9/h9H,2-8H2,1H3/t9-/m1/s1 |
InChiKey: | InChIKey=GHBSPIPJMLAMEP-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.