* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(2,3-DIMETHYLPHENYL)BENZOIC ACID |
| CAS: | 282727-27-9 |
| English Synonyms: | 4-(2,3-DIMETHYLPHENYL)BENZOIC ACID |
| MDL Number.: | MFCD17989624 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | Cc1cccc(c1C)c2ccc(cc2)C(=O)O |
| InChi: | InChI=1S/C15H14O2/c1-10-4-3-5-14(11(10)2)12-6-8-13(9-7-12)15(16)17/h3-9H,1-2H3,(H,16,17) |
| InChiKey: | InChIKey=CNOZOASONVHTNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.