* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | AC9-25 |
CAS: | 284040-76-2 |
English Synonyms: | AC9-25 |
MDL Number.: | MFCD01692079 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)C1(C(=O)NC(=N1)c2c(cccn2)C(=O)O)C.CC(C)N |
InChi: | InChI=1S/C13H15N3O3.C3H9N/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9;1-3(2)4/h4-7H,1-3H3,(H,17,18)(H,15,16,19);3H,4H2,1-2H3 |
InChiKey: | InChIKey=KCTKQZUYHSKJLP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.