* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIO-ARA-C |
CAS: | 28419-39-8 |
English Synonyms: | THIO-ARA-C |
MDL Number.: | MFCD01689265 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1cnc(=S)n(c1)O[C@H]2[C@H]([C@@H]([C@H](O2)CO)O)O.Cl |
InChi: | InChI=1S/C9H12N2O5S.ClH/c12-4-5-6(13)7(14)8(15-5)16-11-3-1-2-10-9(11)17;/h1-3,5-8,12-14H,4H2;1H/t5-,6-,7+,8+;/m1./s1 |
InChiKey: | InChIKey=YVNBYCXFKOLNHB-VOTWZCNTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.